C13H17NO2 — CID 91565927
ethane;4-hydroxy-1,3-dimethylquinolin-2-one (PubChem CID 91565927) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is ethane;4-hydroxy-1,3-dimethylquinolin-2-one.
| Compound Name | ethane;4-hydroxy-1,3-dimethylquinolin-2-one |
|---|---|
| PubChem CID | 91565927 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | ethane;4-hydroxy-1,3-dimethylquinolin-2-one |
| SMILES | CC.Cc1c(O)c2ccccc2n(C)c1=O |
| InChI | InChI=1S/C11H11NO2.C2H6/c1-7-10(13)8-5-3-4-6-9(8)12(2)11(7)14;1-2/h3-6,13H,1-2H3;1-2H3 |
| InChIKey | IDLMVKSHYIIYIO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |