C14H11NO4 — CID 110273333
4-hydroxy-3,6-dimethylpyrano[3,2-c]quinoline-2,5-dione (PubChem CID 110273333) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-hydroxy-3,6-dimethylpyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 4-hydroxy-3,6-dimethylpyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 110273333 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-hydroxy-3,6-dimethylpyrano[3,2-c]quinoline-2,5-dione |
| SMILES | Cc1c(O)c2c(=O)n(C)c3ccccc3c2oc1=O |
| InChI | InChI=1S/C14H11NO4/c1-7-11(16)10-12(19-14(7)18)8-5-3-4-6-9(8)15(2)13(10)17/h3-6,16H,1-2H3 |
| InChIKey | KMIBLEDSSUUNPZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|