C19H12INO4 — CID 2784493
3-iodo-6-methyl-4-phenoxypyrano[3,2-c]quinoline-2,5-dione (PubChem CID 2784493) has the molecular formula C19H12INO4 and a molecular weight of 445.21 g/mol. Its IUPAC name is 3-iodo-6-methyl-4-phenoxypyrano[3,2-c]quinoline-2,5-dione.
| Compound Name | 3-iodo-6-methyl-4-phenoxypyrano[3,2-c]quinoline-2,5-dione |
|---|---|
| PubChem CID | 2784493 |
| Molecular Formula | C19H12INO4 |
| Molecular Weight | 445.21 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | 3-iodo-6-methyl-4-phenoxypyrano[3,2-c]quinoline-2,5-dione |
| SMILES | Cn1c(=O)c2c(Oc3ccccc3)c(I)c(=O)oc2c2ccccc21 |
| InChI | InChI=1S/C19H12INO4/c1-21-13-10-6-5-9-12(13)16-14(18(21)22)17(15(20)19(23)25-16)24-11-7-3-2-4-8-11/h2-10H,1H3 |
| InChIKey | PQTKUBKATGLLHD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|