C27H24N2O2 — CID 18887677
2-anilino-5-methyl-3-(4-propan-2-ylphenyl)furo[3,2-c]quinolin-4-one (PubChem CID 18887677) has the molecular formula C27H24N2O2 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-anilino-5-methyl-3-(4-propan-2-ylphenyl)furo[3,2-c]quinolin-4-one.
| Compound Name | 2-anilino-5-methyl-3-(4-propan-2-ylphenyl)furo[3,2-c]quinolin-4-one |
|---|---|
| PubChem CID | 18887677 |
| Molecular Formula | C27H24N2O2 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-anilino-5-methyl-3-(4-propan-2-ylphenyl)furo[3,2-c]quinolin-4-one |
| SMILES | CC(C)c1ccc(-c2c(Nc3ccccc3)oc3c2c(=O)n(C)c2ccccc32)cc1 |
| InChI | InChI=1S/C27H24N2O2/c1-17(2)18-13-15-19(16-14-18)23-24-25(31-26(23)28-20-9-5-4-6-10-20)21-11-7-8-12-22(21)29(3)27(24)30/h4-17,28H,1-3H3 |
| InChIKey | PDCKYQVPEUQMJI-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |