C25H19N3O4 — CID 18887719
5-methyl-2-(2-methylanilino)-3-(3-nitrophenyl)furo[3,2-c]quinolin-4-one (PubChem CID 18887719) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is 5-methyl-2-(2-methylanilino)-3-(3-nitrophenyl)furo[3,2-c]quinolin-4-one.
| Compound Name | 5-methyl-2-(2-methylanilino)-3-(3-nitrophenyl)furo[3,2-c]quinolin-4-one |
|---|---|
| PubChem CID | 18887719 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 5-methyl-2-(2-methylanilino)-3-(3-nitrophenyl)furo[3,2-c]quinolin-4-one |
| SMILES | Cc1ccccc1Nc1oc2c(c1-c1cccc([N+](=O)[O-])c1)c(=O)n(C)c1ccccc21 |
| InChI | InChI=1S/C25H19N3O4/c1-15-8-3-5-12-19(15)26-24-21(16-9-7-10-17(14-16)28(30)31)22-23(32-24)18-11-4-6-13-20(18)27(2)25(22)29/h3-14,26H,1-2H3 |
| InChIKey | OQHCPKRQDDVWDE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|