C24H16Cl2N2O2 — CID 18887688
2-anilino-3-(3,4-dichlorophenyl)-5-methylfuro[3,2-c]quinolin-4-one (PubChem CID 18887688) has the molecular formula C24H16Cl2N2O2 and a molecular weight of 435.31 g/mol. Its IUPAC name is 2-anilino-3-(3,4-dichlorophenyl)-5-methylfuro[3,2-c]quinolin-4-one.
| Compound Name | 2-anilino-3-(3,4-dichlorophenyl)-5-methylfuro[3,2-c]quinolin-4-one |
|---|---|
| PubChem CID | 18887688 |
| Molecular Formula | C24H16Cl2N2O2 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 2-anilino-3-(3,4-dichlorophenyl)-5-methylfuro[3,2-c]quinolin-4-one |
| SMILES | Cn1c(=O)c2c(-c3ccc(Cl)c(Cl)c3)c(Nc3ccccc3)oc2c2ccccc21 |
| InChI | InChI=1S/C24H16Cl2N2O2/c1-28-19-10-6-5-9-16(19)22-21(24(28)29)20(14-11-12-17(25)18(26)13-14)23(30-22)27-15-7-3-2-4-8-15/h2-13,27H,1H3 |
| InChIKey | JLPJTAGKIRZQKA-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |