C26H22N2O3 — CID 18887696
2-anilino-3-(4-ethoxyphenyl)-5-methylfuro[3,2-c]quinolin-4-one (PubChem CID 18887696) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-anilino-3-(4-ethoxyphenyl)-5-methylfuro[3,2-c]quinolin-4-one.
| Compound Name | 2-anilino-3-(4-ethoxyphenyl)-5-methylfuro[3,2-c]quinolin-4-one |
|---|---|
| PubChem CID | 18887696 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-anilino-3-(4-ethoxyphenyl)-5-methylfuro[3,2-c]quinolin-4-one |
| SMILES | CCOc1ccc(-c2c(Nc3ccccc3)oc3c2c(=O)n(C)c2ccccc32)cc1 |
| InChI | InChI=1S/C26H22N2O3/c1-3-30-19-15-13-17(14-16-19)22-23-24(31-25(22)27-18-9-5-4-6-10-18)20-11-7-8-12-21(20)28(2)26(23)29/h4-16,27H,3H2,1-2H3 |
| InChIKey | PHORDAVYARKTCF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |