C23H14FNO3 — CID 18887562
2-anilino-3-(4-fluorophenyl)furo[3,2-c]chromen-4-one (PubChem CID 18887562) has the molecular formula C23H14FNO3 and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-anilino-3-(4-fluorophenyl)furo[3,2-c]chromen-4-one.
| Compound Name | 2-anilino-3-(4-fluorophenyl)furo[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 18887562 |
| Molecular Formula | C23H14FNO3 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 2-anilino-3-(4-fluorophenyl)furo[3,2-c]chromen-4-one |
| SMILES | O=c1oc2ccccc2c2oc(Nc3ccccc3)c(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C23H14FNO3/c24-15-12-10-14(11-13-15)19-20-21(17-8-4-5-9-18(17)27-23(20)26)28-22(19)25-16-6-2-1-3-7-16/h1-13,25H |
| InChIKey | IQAKSFAKJLCHFP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|