C23H20ClNO3 — CID 11280858
3-(4-chlorophenyl)-2-(cyclohexylamino)furo[3,2-c]chromen-4-one (PubChem CID 11280858) has the molecular formula C23H20ClNO3 and a molecular weight of 393.87 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(cyclohexylamino)furo[3,2-c]chromen-4-one.
| Compound Name | 3-(4-chlorophenyl)-2-(cyclohexylamino)furo[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 11280858 |
| Molecular Formula | C23H20ClNO3 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(cyclohexylamino)furo[3,2-c]chromen-4-one |
| SMILES | O=c1oc2ccccc2c2oc(NC3CCCCC3)c(-c3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C23H20ClNO3/c24-15-12-10-14(11-13-15)19-20-21(17-8-4-5-9-18(17)27-23(20)26)28-22(19)25-16-6-2-1-3-7-16/h4-5,8-13,16,25H,1-3,6-7H2 |
| InChIKey | NNXVNBLVCLICON-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|