C20H22ClNO5 — CID 15506557
dimethyl 2-(4-chlorophenyl)-5-(cyclohexylamino)furan-3,4-dicarboxylate (PubChem CID 15506557) has the molecular formula C20H22ClNO5 and a molecular weight of 391.85 g/mol. Its IUPAC name is dimethyl 2-(4-chlorophenyl)-5-(cyclohexylamino)furan-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(4-chlorophenyl)-5-(cyclohexylamino)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 15506557 |
| Molecular Formula | C20H22ClNO5 |
| Molecular Weight | 391.85 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | dimethyl 2-(4-chlorophenyl)-5-(cyclohexylamino)furan-3,4-dicarboxylate |
| SMILES | COC(=O)c1c(NC2CCCCC2)oc(-c2ccc(Cl)cc2)c1C(=O)OC |
| InChI | InChI=1S/C20H22ClNO5/c1-25-19(23)15-16(20(24)26-2)18(22-14-6-4-3-5-7-14)27-17(15)12-8-10-13(21)11-9-12/h8-11,14,22H,3-7H2,1-2H3 |
| InChIKey | SHDGLWBLMYZAOJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.85 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |