C22H16N6O4 — CID 135859945
6,11-dimethyl-8-(3-nitrophenyl)-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione (PubChem CID 135859945) has the molecular formula C22H16N6O4 and a molecular weight of 428.41 g/mol. Its IUPAC name is 6,11-dimethyl-8-(3-nitrophenyl)-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione.
| Compound Name | 6,11-dimethyl-8-(3-nitrophenyl)-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione |
|---|---|
| PubChem CID | 135859945 |
| Molecular Formula | C22H16N6O4 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 6,11-dimethyl-8-(3-nitrophenyl)-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione |
| SMILES | Cc1nn(-c2ccccc2)c2nc3[nH]c(=O)n(C)c(=O)c3c(-c3cccc([N+](=O)[O-])c3)c12 |
| InChI | InChI=1S/C22H16N6O4/c1-12-16-17(13-7-6-10-15(11-13)28(31)32)18-19(24-22(30)26(2)21(18)29)23-20(16)27(25-12)14-8-4-3-5-9-14/h3-11H,1-2H3,(H,23,24,30) |
| InChIKey | FUFACQQNVKQJBH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|