C20H15N5O2S — CID 135859946
6,11-dimethyl-4-phenyl-8-thiophen-2-yl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione (PubChem CID 135859946) has the molecular formula C20H15N5O2S and a molecular weight of 389.44 g/mol. Its IUPAC name is 6,11-dimethyl-4-phenyl-8-thiophen-2-yl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione.
| Compound Name | 6,11-dimethyl-4-phenyl-8-thiophen-2-yl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione |
|---|---|
| PubChem CID | 135859946 |
| Molecular Formula | C20H15N5O2S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 6,11-dimethyl-4-phenyl-8-thiophen-2-yl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraene-10,12-dione |
| SMILES | Cc1nn(-c2ccccc2)c2nc3[nH]c(=O)n(C)c(=O)c3c(-c3cccs3)c12 |
| InChI | InChI=1S/C20H15N5O2S/c1-11-14-15(13-9-6-10-28-13)16-17(22-20(27)24(2)19(16)26)21-18(14)25(23-11)12-7-4-3-5-8-12/h3-10H,1-2H3,(H,21,22,27) |
| InChIKey | MLYFQGBTNBOATJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |