C22H21N3S — CID 53472904
3-methyl-5-phenyl-8-thiophen-2-yl-4,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2(6),3,7-tetraene (PubChem CID 53472904) has the molecular formula C22H21N3S and a molecular weight of 359.50 g/mol. Its IUPAC name is 3-methyl-5-phenyl-8-thiophen-2-yl-4,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2(6),3,7-tetraene.
| Compound Name | 3-methyl-5-phenyl-8-thiophen-2-yl-4,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2(6),3,7-tetraene |
|---|---|
| PubChem CID | 53472904 |
| Molecular Formula | C22H21N3S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-methyl-5-phenyl-8-thiophen-2-yl-4,5,7-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2(6),3,7-tetraene |
| SMILES | Cc1nn(-c2ccccc2)c2nc(-c3cccs3)c3c(c12)CCCCC3 |
| InChI | InChI=1S/C22H21N3S/c1-15-20-17-11-6-3-7-12-18(17)21(19-13-8-14-26-19)23-22(20)25(24-15)16-9-4-2-5-10-16/h2,4-5,8-10,13-14H,3,6-7,11-12H2,1H3 |
| InChIKey | KCKXUYUKHUJKQZ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |