C18H14N4O3 — CID 124925417
4-methoxy-3-methyl-1-(3-nitrophenyl)pyrazolo[3,4-b]quinoline (PubChem CID 124925417) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 4-methoxy-3-methyl-1-(3-nitrophenyl)pyrazolo[3,4-b]quinoline.
| Compound Name | 4-methoxy-3-methyl-1-(3-nitrophenyl)pyrazolo[3,4-b]quinoline |
|---|---|
| PubChem CID | 124925417 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-methoxy-3-methyl-1-(3-nitrophenyl)pyrazolo[3,4-b]quinoline |
| SMILES | COc1c2ccccc2nc2c1c(C)nn2-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14N4O3/c1-11-16-17(25-2)14-8-3-4-9-15(14)19-18(16)21(20-11)12-6-5-7-13(10-12)22(23)24/h3-10H,1-2H3 |
| InChIKey | ADHOBIRHRTYELI-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|