C10H7N5O3 — CID 11086031
6-methyl-4-(3-nitrophenyl)pyrazolo[3,4-c][1,2,5]oxadiazole (PubChem CID 11086031) has the molecular formula C10H7N5O3 and a molecular weight of 245.20 g/mol. Its IUPAC name is 6-methyl-4-(3-nitrophenyl)pyrazolo[3,4-c][1,2,5]oxadiazole.
| Compound Name | 6-methyl-4-(3-nitrophenyl)pyrazolo[3,4-c][1,2,5]oxadiazole |
|---|---|
| PubChem CID | 11086031 |
| Molecular Formula | C10H7N5O3 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 6-methyl-4-(3-nitrophenyl)pyrazolo[3,4-c][1,2,5]oxadiazole |
| SMILES | Cc1nn(-c2cccc([N+](=O)[O-])c2)c2nonc12 |
| InChI | InChI=1S/C10H7N5O3/c1-6-9-10(13-18-12-9)14(11-6)7-3-2-4-8(5-7)15(16)17/h2-5H,1H3 |
| InChIKey | VKUJEBVOZZBCFK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 99.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|