C11H9N5O4S — CID 116647241
4-cyano-3-methyl-1-(3-nitrophenyl)pyrazole-5-sulfonamide (PubChem CID 116647241) has the molecular formula C11H9N5O4S and a molecular weight of 307.29 g/mol. Its IUPAC name is 4-cyano-3-methyl-1-(3-nitrophenyl)pyrazole-5-sulfonamide.
| Compound Name | 4-cyano-3-methyl-1-(3-nitrophenyl)pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 116647241 |
| Molecular Formula | C11H9N5O4S |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 4-cyano-3-methyl-1-(3-nitrophenyl)pyrazole-5-sulfonamide |
| SMILES | Cc1nn(-c2cccc([N+](=O)[O-])c2)c(S(N)(=O)=O)c1C#N |
| InChI | InChI=1S/C11H9N5O4S/c1-7-10(6-12)11(21(13,19)20)15(14-7)8-3-2-4-9(5-8)16(17)18/h2-5H,1H3,(H2,13,19,20) |
| InChIKey | BMTZXHGLMTUEGF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|