C12H10N4O3 — CID 63753195
1,3-dimethyl-5-(3-nitrophenoxy)pyrazole-4-carbonitrile (PubChem CID 63753195) has the molecular formula C12H10N4O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-nitrophenoxy)pyrazole-4-carbonitrile.
| Compound Name | 1,3-dimethyl-5-(3-nitrophenoxy)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 63753195 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1,3-dimethyl-5-(3-nitrophenoxy)pyrazole-4-carbonitrile |
| SMILES | Cc1nn(C)c(Oc2cccc([N+](=O)[O-])c2)c1C#N |
| InChI | InChI=1S/C12H10N4O3/c1-8-11(7-13)12(15(2)14-8)19-10-5-3-4-9(6-10)16(17)18/h3-6H,1-2H3 |
| InChIKey | FBBJPNFTWLDYIK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 93.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|