C13H13N5O2 — CID 63757170
1,3-dimethyl-5-[(3-nitrophenyl)methylamino]pyrazole-4-carbonitrile (PubChem CID 63757170) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(3-nitrophenyl)methylamino]pyrazole-4-carbonitrile.
| Compound Name | 1,3-dimethyl-5-[(3-nitrophenyl)methylamino]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 63757170 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 1,3-dimethyl-5-[(3-nitrophenyl)methylamino]pyrazole-4-carbonitrile |
| SMILES | Cc1nn(C)c(NCc2cccc([N+](=O)[O-])c2)c1C#N |
| InChI | InChI=1S/C13H13N5O2/c1-9-12(7-14)13(17(2)16-9)15-8-10-4-3-5-11(6-10)18(19)20/h3-6,15H,8H2,1-2H3 |
| InChIKey | LFBVZCMKEJDYPW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|