C15H19N5O4S — CID 133472023
N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-1,3-dimethyl-4-nitropyrazol-5-amine (PubChem CID 133472023) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-1,3-dimethyl-4-nitropyrazol-5-amine.
| Compound Name | N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-1,3-dimethyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 133472023 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-1,3-dimethyl-4-nitropyrazol-5-amine |
| SMILES | Cc1nn(C)c(NCc2cccc(N3CCCS3(=O)=O)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N5O4S/c1-11-14(20(21)22)15(18(2)17-11)16-10-12-5-3-6-13(9-12)19-7-4-8-25(19,23)24/h3,5-6,9,16H,4,7-8,10H2,1-2H3 |
| InChIKey | LTLLBNUMNPEYFG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|