C17H18ClN3O4S — CID 133471937
2-chloro-N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-5-methyl-4-nitroaniline (PubChem CID 133471937) has the molecular formula C17H18ClN3O4S and a molecular weight of 395.87 g/mol. Its IUPAC name is 2-chloro-N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-5-methyl-4-nitroaniline.
| Compound Name | 2-chloro-N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-5-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 133471937 |
| Molecular Formula | C17H18ClN3O4S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-chloro-N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-5-methyl-4-nitroaniline |
| SMILES | Cc1cc(NCc2cccc(N3CCCS3(=O)=O)c2)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H18ClN3O4S/c1-12-8-16(15(18)10-17(12)21(22)23)19-11-13-4-2-5-14(9-13)20-6-3-7-26(20,24)25/h2,4-5,8-10,19H,3,6-7,11H2,1H3 |
| InChIKey | FQOYGSGINZKYNA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|