C15H15BrN4O4S — CID 133471773
5-bromo-N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-3-nitropyridin-2-amine (PubChem CID 133471773) has the molecular formula C15H15BrN4O4S and a molecular weight of 427.28 g/mol. Its IUPAC name is 5-bromo-N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-3-nitropyridin-2-amine.
| Compound Name | 5-bromo-N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133471773 |
| Molecular Formula | C15H15BrN4O4S |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 5-bromo-N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1NCc1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C15H15BrN4O4S/c16-12-8-14(20(21)22)15(18-10-12)17-9-11-3-1-4-13(7-11)19-5-2-6-25(19,23)24/h1,3-4,7-8,10H,2,5-6,9H2,(H,17,18) |
| InChIKey | NJZAJOMIFNIWIO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|