C15H16N6O2S — CID 133472021
N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-7H-purin-6-amine (PubChem CID 133472021) has the molecular formula C15H16N6O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-7H-purin-6-amine.
| Compound Name | N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 133472021 |
| Molecular Formula | C15H16N6O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]methyl]-7H-purin-6-amine |
| SMILES | O=S1(=O)CCCN1c1cccc(CNc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C15H16N6O2S/c22-24(23)6-2-5-21(24)12-4-1-3-11(7-12)8-16-14-13-15(18-9-17-13)20-10-19-14/h1,3-4,7,9-10H,2,5-6,8H2,(H2,16,17,18,19,20) |
| InChIKey | UHAMUGIWXMOEHY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |