About 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline
2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline (PubChem CID 133434046) has the molecular formula C14H20ClN3O4S
and a molecular weight of 361.85 g/mol. Its IUPAC name is 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline.
Molecular Properties
| Compound Name | 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline |
| PubChem CID | 133434046 |
| Molecular Formula | C14H20ClN3O4S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline |
| SMILES | Cc1cc(NCCCN2CCS(=O)(=O)CC2)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H20ClN3O4S/c1-11-9-13(12(15)10-14(11)18(19)20)16-3-2-4-17-5-7-23(21,22)8-6-17/h9-10,16H,2-8H2,1H3 |
| InChIKey | JEWAETSTPBPABF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline?
The IUPAC name of 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline (CID 133434046) is 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline.
What is the SMILES notation for 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline?
The canonical SMILES for 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline is Cc1cc(NCCCN2CCS(=O)(=O)CC2)c(Cl)cc1[N+](=O)[O-].
What is the InChIKey of 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline?
The InChIKey is JEWAETSTPBPABF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClN3O4S/c1-11-9-13(12(15)10-14(11)18(19)20)16-3-2-4-17-5-7-23(21,22)8-6-17/h9-10,16H,2-8H2,1H3.
What are the key properties of 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline?
2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline has a molecular weight of 361.85 g/mol, XLogP of 2.09, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]-5-methyl-4-nitroaniline is sourced from PubChem (CID 133434046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).