C15H22N4O2S — CID 133433965
4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-2,6-dimethylpyridine-3-carbonitrile (PubChem CID 133433965) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-2,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-2,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133433965 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propylamino]-2,6-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cc(NCCCN2CCS(=O)(=O)CC2)c(C#N)c(C)n1 |
| InChI | InChI=1S/C15H22N4O2S/c1-12-10-15(14(11-16)13(2)18-12)17-4-3-5-19-6-8-22(20,21)9-7-19/h10H,3-9H2,1-2H3,(H,17,18) |
| InChIKey | LYAVENWNDSDXJD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|