C14H20N4 — CID 81052089
4-[3-(cyclopropylamino)propylamino]-2,6-dimethylpyridine-3-carbonitrile (PubChem CID 81052089) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-[3-(cyclopropylamino)propylamino]-2,6-dimethylpyridine-3-carbonitrile.
| Compound Name | 4-[3-(cyclopropylamino)propylamino]-2,6-dimethylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 81052089 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-[3-(cyclopropylamino)propylamino]-2,6-dimethylpyridine-3-carbonitrile |
| SMILES | Cc1cc(NCCCNC2CC2)c(C#N)c(C)n1 |
| InChI | InChI=1S/C14H20N4/c1-10-8-14(13(9-15)11(2)18-10)17-7-3-6-16-12-4-5-12/h8,12,16H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | KFXIEOSYBFJHHT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|