C14H19N3 — CID 54934036
4-[3-(cyclopropylamino)propylamino]-3-methylbenzonitrile (PubChem CID 54934036) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 4-[3-(cyclopropylamino)propylamino]-3-methylbenzonitrile.
| Compound Name | 4-[3-(cyclopropylamino)propylamino]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 54934036 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 4-[3-(cyclopropylamino)propylamino]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1NCCCNC1CC1 |
| InChI | InChI=1S/C14H19N3/c1-11-9-12(10-15)3-6-14(11)17-8-2-7-16-13-4-5-13/h3,6,9,13,16-17H,2,4-5,7-8H2,1H3 |
| InChIKey | OIQVWGRALMVQDS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|