C15H20N2O2 — CID 54934556
7-(4-cyano-2-methylanilino)heptanoic acid (PubChem CID 54934556) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 7-(4-cyano-2-methylanilino)heptanoic acid.
| Compound Name | 7-(4-cyano-2-methylanilino)heptanoic acid |
|---|---|
| PubChem CID | 54934556 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 7-(4-cyano-2-methylanilino)heptanoic acid |
| SMILES | Cc1cc(C#N)ccc1NCCCCCCC(=O)O |
| InChI | InChI=1S/C15H20N2O2/c1-12-10-13(11-16)7-8-14(12)17-9-5-3-2-4-6-15(18)19/h7-8,10,17H,2-6,9H2,1H3,(H,18,19) |
| InChIKey | BQLHMTSSZNSZJS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|