C12H16ClNO2 — CID 28972078
5-(4-chloro-2-methylanilino)pentanoic acid (PubChem CID 28972078) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 5-(4-chloro-2-methylanilino)pentanoic acid.
| Compound Name | 5-(4-chloro-2-methylanilino)pentanoic acid |
|---|---|
| PubChem CID | 28972078 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 5-(4-chloro-2-methylanilino)pentanoic acid |
| SMILES | Cc1cc(Cl)ccc1NCCCCC(=O)O |
| InChI | InChI=1S/C12H16ClNO2/c1-9-8-10(13)5-6-11(9)14-7-3-2-4-12(15)16/h5-6,8,14H,2-4,7H2,1H3,(H,15,16) |
| InChIKey | XFWBFZNTIGCMEI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|