C12H13ClN2O4 — CID 28746604
4-[(4-chloro-2-methylphenyl)carbamoylamino]-4-oxobutanoic acid (PubChem CID 28746604) has the molecular formula C12H13ClN2O4 and a molecular weight of 284.70 g/mol. Its IUPAC name is 4-[(4-chloro-2-methylphenyl)carbamoylamino]-4-oxobutanoic acid.
| Compound Name | 4-[(4-chloro-2-methylphenyl)carbamoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 28746604 |
| Molecular Formula | C12H13ClN2O4 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 4-[(4-chloro-2-methylphenyl)carbamoylamino]-4-oxobutanoic acid |
| SMILES | Cc1cc(Cl)ccc1NC(=O)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C12H13ClN2O4/c1-7-6-8(13)2-3-9(7)14-12(19)15-10(16)4-5-11(17)18/h2-3,6H,4-5H2,1H3,(H,17,18)(H2,14,15,16,19) |
| InChIKey | DCKGDHMPZGAFIF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |