C11H17ClN2 — CID 18324833
N'-(4-chloro-2-methylphenyl)-N-methylpropane-1,3-diamine (PubChem CID 18324833) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is N'-(4-chloro-2-methylphenyl)-N-methylpropane-1,3-diamine.
| Compound Name | N'-(4-chloro-2-methylphenyl)-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 18324833 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N'-(4-chloro-2-methylphenyl)-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNc1ccc(Cl)cc1C |
| InChI | InChI=1S/C11H17ClN2/c1-9-8-10(12)4-5-11(9)14-7-3-6-13-2/h4-5,8,13-14H,3,6-7H2,1-2H3 |
| InChIKey | GKRCLSKEJRKSNB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|