C21H32N4 — CID 124926554
N'-[4-[[4-(3-aminopropylamino)-3-methylphenyl]methyl]-2-methylphenyl]propane-1,3-diamine (PubChem CID 124926554) has the molecular formula C21H32N4 and a molecular weight of 340.52 g/mol. Its IUPAC name is N'-[4-[[4-(3-aminopropylamino)-3-methylphenyl]methyl]-2-methylphenyl]propane-1,3-diamine.
| Compound Name | N'-[4-[[4-(3-aminopropylamino)-3-methylphenyl]methyl]-2-methylphenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 124926554 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | N'-[4-[[4-(3-aminopropylamino)-3-methylphenyl]methyl]-2-methylphenyl]propane-1,3-diamine |
| SMILES | Cc1cc(Cc2ccc(NCCCN)c(C)c2)ccc1NCCCN |
| InChI | InChI=1S/C21H32N4/c1-16-13-18(5-7-20(16)24-11-3-9-22)15-19-6-8-21(17(2)14-19)25-12-4-10-23/h5-8,13-14,24-25H,3-4,9-12,15,22-23H2,1-2H3 |
| InChIKey | JRZJBAGFJNMECY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|