C9H15N3 — CID 66273701
N'-(4-methyl-3-pyridinyl)propane-1,3-diamine (PubChem CID 66273701) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is N'-(4-methyl-3-pyridinyl)propane-1,3-diamine.
| Compound Name | N'-(4-methyl-3-pyridinyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 66273701 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | N'-(4-methyl-3-pyridinyl)propane-1,3-diamine |
| SMILES | Cc1ccncc1NCCCN |
| InChI | InChI=1S/C9H15N3/c1-8-3-6-11-7-9(8)12-5-2-4-10/h3,6-7,12H,2,4-5,10H2,1H3 |
| InChIKey | UPAKSSJJQTYMJO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|