C7H10FN3 — CID 112703774
N'-(3-fluoro-4-pyridinyl)ethane-1,2-diamine (PubChem CID 112703774) has the molecular formula C7H10FN3 and a molecular weight of 155.18 g/mol. Its IUPAC name is N'-(3-fluoro-4-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-(3-fluoro-4-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 112703774 |
| Molecular Formula | C7H10FN3 |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | N'-(3-fluoro-4-pyridinyl)ethane-1,2-diamine |
| SMILES | NCCNc1ccncc1F |
| InChI | InChI=1S/C7H10FN3/c8-6-5-10-3-1-7(6)11-4-2-9/h1,3,5H,2,4,9H2,(H,10,11) |
| InChIKey | YXYCFKVTIWIXGO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |