C13H20FN3O — CID 134711273
[1-[2-[(3-fluoro-4-pyridinyl)amino]ethyl]piperidin-2-yl]methanol (PubChem CID 134711273) has the molecular formula C13H20FN3O and a molecular weight of 253.32 g/mol. Its IUPAC name is [1-[2-[(3-fluoro-4-pyridinyl)amino]ethyl]piperidin-2-yl]methanol.
| Compound Name | [1-[2-[(3-fluoro-4-pyridinyl)amino]ethyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 134711273 |
| Molecular Formula | C13H20FN3O |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | [1-[2-[(3-fluoro-4-pyridinyl)amino]ethyl]piperidin-2-yl]methanol |
| SMILES | OCC1CCCCN1CCNc1ccncc1F |
| InChI | InChI=1S/C13H20FN3O/c14-12-9-15-5-4-13(12)16-6-8-17-7-2-1-3-11(17)10-18/h4-5,9,11,18H,1-3,6-8,10H2,(H,15,16) |
| InChIKey | OEQQRLSBDRQXGY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |