C14H23FN4O2 — CID 131906846
[1-[3-[(5-fluoro-4-methoxypyrimidin-2-yl)amino]propyl]piperidin-2-yl]methanol (PubChem CID 131906846) has the molecular formula C14H23FN4O2 and a molecular weight of 298.36 g/mol. Its IUPAC name is [1-[3-[(5-fluoro-4-methoxypyrimidin-2-yl)amino]propyl]piperidin-2-yl]methanol.
| Compound Name | [1-[3-[(5-fluoro-4-methoxypyrimidin-2-yl)amino]propyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 131906846 |
| Molecular Formula | C14H23FN4O2 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [1-[3-[(5-fluoro-4-methoxypyrimidin-2-yl)amino]propyl]piperidin-2-yl]methanol |
| SMILES | COc1nc(NCCCN2CCCCC2CO)ncc1F |
| InChI | InChI=1S/C14H23FN4O2/c1-21-13-12(15)9-17-14(18-13)16-6-4-8-19-7-3-2-5-11(19)10-20/h9,11,20H,2-8,10H2,1H3,(H,16,17,18) |
| InChIKey | GBRVASMVZMIXNL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|