C8H9F4N3OS — CID 137340626
5-fluoro-4-methoxy-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-2-amine (PubChem CID 137340626) has the molecular formula C8H9F4N3OS and a molecular weight of 271.24 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-methoxy-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 137340626 |
| Molecular Formula | C8H9F4N3OS |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 5-fluoro-4-methoxy-N-[2-(trifluoromethylsulfanyl)ethyl]pyrimidin-2-amine |
| SMILES | COc1nc(NCCSC(F)(F)F)ncc1F |
| InChI | InChI=1S/C8H9F4N3OS/c1-16-6-5(9)4-14-7(15-6)13-2-3-17-8(10,11)12/h4H,2-3H2,1H3,(H,13,14,15) |
| InChIKey | DDAPZTBRDJNDPW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|