C16H20FN3O2 — CID 137343705
5-fluoro-4-methoxy-N-[2-(2,4,6-trimethylphenoxy)ethyl]pyrimidin-2-amine (PubChem CID 137343705) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-N-[2-(2,4,6-trimethylphenoxy)ethyl]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-methoxy-N-[2-(2,4,6-trimethylphenoxy)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 137343705 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 5-fluoro-4-methoxy-N-[2-(2,4,6-trimethylphenoxy)ethyl]pyrimidin-2-amine |
| SMILES | COc1nc(NCCOc2c(C)cc(C)cc2C)ncc1F |
| InChI | InChI=1S/C16H20FN3O2/c1-10-7-11(2)14(12(3)8-10)22-6-5-18-16-19-9-13(17)15(20-16)21-4/h7-9H,5-6H2,1-4H3,(H,18,19,20) |
| InChIKey | FDAAZSIOFCCESX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|