C13H15FN4O — CID 80916575
[5-fluoro-4-(2,3,5-trimethylphenoxy)pyrimidin-2-yl]hydrazine (PubChem CID 80916575) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is [5-fluoro-4-(2,3,5-trimethylphenoxy)pyrimidin-2-yl]hydrazine.
| Compound Name | [5-fluoro-4-(2,3,5-trimethylphenoxy)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80916575 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [5-fluoro-4-(2,3,5-trimethylphenoxy)pyrimidin-2-yl]hydrazine |
| SMILES | Cc1cc(C)c(C)c(Oc2nc(NN)ncc2F)c1 |
| InChI | InChI=1S/C13H15FN4O/c1-7-4-8(2)9(3)11(5-7)19-12-10(14)6-16-13(17-12)18-15/h4-6H,15H2,1-3H3,(H,16,17,18) |
| InChIKey | SPGMAMQGJFAZMS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|