C11H10Cl2N4O — CID 80915153
[4-(2,4-dichlorophenoxy)-5-methylpyrimidin-2-yl]hydrazine (PubChem CID 80915153) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is [4-(2,4-dichlorophenoxy)-5-methylpyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2,4-dichlorophenoxy)-5-methylpyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80915153 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | [4-(2,4-dichlorophenoxy)-5-methylpyrimidin-2-yl]hydrazine |
| SMILES | Cc1cnc(NN)nc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N4O/c1-6-5-15-11(17-14)16-10(6)18-9-3-2-7(12)4-8(9)13/h2-5H,14H2,1H3,(H,15,16,17) |
| InChIKey | IURGBHGTCXHXAS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|