C15H18ClN3O — CID 80880647
4-(2-chloro-4-methylphenoxy)-5-methyl-N-propylpyrimidin-2-amine (PubChem CID 80880647) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 4-(2-chloro-4-methylphenoxy)-5-methyl-N-propylpyrimidin-2-amine.
| Compound Name | 4-(2-chloro-4-methylphenoxy)-5-methyl-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80880647 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-(2-chloro-4-methylphenoxy)-5-methyl-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(C)c(Oc2ccc(C)cc2Cl)n1 |
| InChI | InChI=1S/C15H18ClN3O/c1-4-7-17-15-18-9-11(3)14(19-15)20-13-6-5-10(2)8-12(13)16/h5-6,8-9H,4,7H2,1-3H3,(H,17,18,19) |
| InChIKey | UOUZCZQETVBZOI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |