C13H11Cl4N3O — CID 80866668
5-chloro-N-propyl-4-(2,4,5-trichlorophenoxy)pyrimidin-2-amine (PubChem CID 80866668) has the molecular formula C13H11Cl4N3O and a molecular weight of 367.06 g/mol. Its IUPAC name is 5-chloro-N-propyl-4-(2,4,5-trichlorophenoxy)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-propyl-4-(2,4,5-trichlorophenoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80866668 |
| Molecular Formula | C13H11Cl4N3O |
| Molecular Weight | 367.06 g/mol |
| Exact Mass | 364.97 |
| IUPAC Name | 5-chloro-N-propyl-4-(2,4,5-trichlorophenoxy)pyrimidin-2-amine |
| SMILES | CCCNc1ncc(Cl)c(Oc2cc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H11Cl4N3O/c1-2-3-18-13-19-6-10(17)12(20-13)21-11-5-8(15)7(14)4-9(11)16/h4-6H,2-3H2,1H3,(H,18,19,20) |
| InChIKey | RXLVTTLRXYAZPX-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.06 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|