C16H18ClN3O — CID 80846532
5-chloro-4-[2-[(E)-prop-1-enyl]phenoxy]-N-propylpyrimidin-2-amine (PubChem CID 80846532) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 5-chloro-4-[2-[(E)-prop-1-enyl]phenoxy]-N-propylpyrimidin-2-amine.
| Compound Name | 5-chloro-4-[2-[(E)-prop-1-enyl]phenoxy]-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80846532 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 5-chloro-4-[2-[(E)-prop-1-enyl]phenoxy]-N-propylpyrimidin-2-amine |
| SMILES | C/C=C/c1ccccc1Oc1nc(NCCC)ncc1Cl |
| InChI | InChI=1S/C16H18ClN3O/c1-3-7-12-8-5-6-9-14(12)21-15-13(17)11-19-16(20-15)18-10-4-2/h3,5-9,11H,4,10H2,1-2H3,(H,18,19,20)/b7-3+ |
| InChIKey | MOWPCNVCJFHNIG-XVNBXDOJSA-N |
| XLogP | 4.78 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |