C11H9Cl2N5O3 — CID 80920125
[4-(2,6-dichloro-4-nitrophenoxy)-5-methylpyrimidin-2-yl]hydrazine (PubChem CID 80920125) has the molecular formula C11H9Cl2N5O3 and a molecular weight of 330.13 g/mol. Its IUPAC name is [4-(2,6-dichloro-4-nitrophenoxy)-5-methylpyrimidin-2-yl]hydrazine.
| Compound Name | [4-(2,6-dichloro-4-nitrophenoxy)-5-methylpyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80920125 |
| Molecular Formula | C11H9Cl2N5O3 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | [4-(2,6-dichloro-4-nitrophenoxy)-5-methylpyrimidin-2-yl]hydrazine |
| SMILES | Cc1cnc(NN)nc1Oc1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H9Cl2N5O3/c1-5-4-15-11(17-14)16-10(5)21-9-7(12)2-6(18(19)20)3-8(9)13/h2-4H,14H2,1H3,(H,15,16,17) |
| InChIKey | YTVVGDGVHNMBQH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|