C10H6BrCl2N5O3 — CID 107501836
[5-bromo-4-(4,5-dichloro-2-nitrophenoxy)pyrimidin-2-yl]hydrazine (PubChem CID 107501836) has the molecular formula C10H6BrCl2N5O3 and a molecular weight of 395.00 g/mol. Its IUPAC name is [5-bromo-4-(4,5-dichloro-2-nitrophenoxy)pyrimidin-2-yl]hydrazine.
| Compound Name | [5-bromo-4-(4,5-dichloro-2-nitrophenoxy)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 107501836 |
| Molecular Formula | C10H6BrCl2N5O3 |
| Molecular Weight | 395.00 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | [5-bromo-4-(4,5-dichloro-2-nitrophenoxy)pyrimidin-2-yl]hydrazine |
| SMILES | NNc1ncc(Br)c(Oc2cc(Cl)c(Cl)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H6BrCl2N5O3/c11-4-3-15-10(17-14)16-9(4)21-8-2-6(13)5(12)1-7(8)18(19)20/h1-3H,14H2,(H,15,16,17) |
| InChIKey | NCNSLSOGRLAVNE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.00 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|