C10H5Cl2FN4O3 — CID 107501814
4-(4,5-dichloro-2-nitrophenoxy)-5-fluoropyrimidin-2-amine (PubChem CID 107501814) has the molecular formula C10H5Cl2FN4O3 and a molecular weight of 319.08 g/mol. Its IUPAC name is 4-(4,5-dichloro-2-nitrophenoxy)-5-fluoropyrimidin-2-amine.
| Compound Name | 4-(4,5-dichloro-2-nitrophenoxy)-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 107501814 |
| Molecular Formula | C10H5Cl2FN4O3 |
| Molecular Weight | 319.08 g/mol |
| Exact Mass | 317.97 |
| IUPAC Name | 4-(4,5-dichloro-2-nitrophenoxy)-5-fluoropyrimidin-2-amine |
| SMILES | Nc1ncc(F)c(Oc2cc(Cl)c(Cl)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C10H5Cl2FN4O3/c11-4-1-7(17(18)19)8(2-5(4)12)20-9-6(13)3-15-10(14)16-9/h1-3H,(H2,14,15,16) |
| InChIKey | WNNHAOCFPHDYAA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.08 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|