C10H5BrCl2FN3O — CID 107662603
4-(4-bromo-2,5-dichlorophenoxy)-5-fluoropyrimidin-2-amine (PubChem CID 107662603) has the molecular formula C10H5BrCl2FN3O and a molecular weight of 352.98 g/mol. Its IUPAC name is 4-(4-bromo-2,5-dichlorophenoxy)-5-fluoropyrimidin-2-amine.
| Compound Name | 4-(4-bromo-2,5-dichlorophenoxy)-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 107662603 |
| Molecular Formula | C10H5BrCl2FN3O |
| Molecular Weight | 352.98 g/mol |
| Exact Mass | 350.90 |
| IUPAC Name | 4-(4-bromo-2,5-dichlorophenoxy)-5-fluoropyrimidin-2-amine |
| SMILES | Nc1ncc(F)c(Oc2cc(Cl)c(Br)cc2Cl)n1 |
| InChI | InChI=1S/C10H5BrCl2FN3O/c11-4-1-6(13)8(2-5(4)12)18-9-7(14)3-16-10(15)17-9/h1-3H,(H2,15,16,17) |
| InChIKey | WJITZAQKIKPLJQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.98 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|