C12H9BrCl2N2O — CID 107655311
2-(4-bromo-2,5-dichlorophenoxy)-5-methylpyridin-4-amine (PubChem CID 107655311) has the molecular formula C12H9BrCl2N2O and a molecular weight of 348.03 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dichlorophenoxy)-5-methylpyridin-4-amine.
| Compound Name | 2-(4-bromo-2,5-dichlorophenoxy)-5-methylpyridin-4-amine |
|---|---|
| PubChem CID | 107655311 |
| Molecular Formula | C12H9BrCl2N2O |
| Molecular Weight | 348.03 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | 2-(4-bromo-2,5-dichlorophenoxy)-5-methylpyridin-4-amine |
| SMILES | Cc1cnc(Oc2cc(Cl)c(Br)cc2Cl)cc1N |
| InChI | InChI=1S/C12H9BrCl2N2O/c1-6-5-17-12(4-10(6)16)18-11-3-8(14)7(13)2-9(11)15/h2-5H,1H3,(H2,16,17) |
| InChIKey | CSEONUCFMOJNCE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.03 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|