C11H6BrCl3N2O — CID 107657822
4-(4-bromo-2,5-dichlorophenoxy)-6-chloro-2-methylpyrimidine (PubChem CID 107657822) has the molecular formula C11H6BrCl3N2O and a molecular weight of 368.45 g/mol. Its IUPAC name is 4-(4-bromo-2,5-dichlorophenoxy)-6-chloro-2-methylpyrimidine.
| Compound Name | 4-(4-bromo-2,5-dichlorophenoxy)-6-chloro-2-methylpyrimidine |
|---|---|
| PubChem CID | 107657822 |
| Molecular Formula | C11H6BrCl3N2O |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 365.87 |
| IUPAC Name | 4-(4-bromo-2,5-dichlorophenoxy)-6-chloro-2-methylpyrimidine |
| SMILES | Cc1nc(Cl)cc(Oc2cc(Cl)c(Br)cc2Cl)n1 |
| InChI | InChI=1S/C11H6BrCl3N2O/c1-5-16-10(15)4-11(17-5)18-9-3-7(13)6(12)2-8(9)14/h2-4H,1H3 |
| InChIKey | QWCXVYUIYIHGQU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|