C12H10BrCl2N3O2 — CID 107662690
6-(4-bromo-2,5-dichlorophenoxy)-2-(methoxymethyl)pyrimidin-4-amine (PubChem CID 107662690) has the molecular formula C12H10BrCl2N3O2 and a molecular weight of 379.04 g/mol. Its IUPAC name is 6-(4-bromo-2,5-dichlorophenoxy)-2-(methoxymethyl)pyrimidin-4-amine.
| Compound Name | 6-(4-bromo-2,5-dichlorophenoxy)-2-(methoxymethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 107662690 |
| Molecular Formula | C12H10BrCl2N3O2 |
| Molecular Weight | 379.04 g/mol |
| Exact Mass | 376.93 |
| IUPAC Name | 6-(4-bromo-2,5-dichlorophenoxy)-2-(methoxymethyl)pyrimidin-4-amine |
| SMILES | COCc1nc(N)cc(Oc2cc(Cl)c(Br)cc2Cl)n1 |
| InChI | InChI=1S/C12H10BrCl2N3O2/c1-19-5-11-17-10(16)4-12(18-11)20-9-3-7(14)6(13)2-8(9)15/h2-4H,5H2,1H3,(H2,16,17,18) |
| InChIKey | AKTLKBTYPFYHHK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.04 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|