C12H11BrCl2N4O — CID 107794910
4-N-(4-bromo-2,3-dichlorophenyl)-2-(methoxymethyl)pyrimidine-4,6-diamine (PubChem CID 107794910) has the molecular formula C12H11BrCl2N4O and a molecular weight of 378.06 g/mol. Its IUPAC name is 4-N-(4-bromo-2,3-dichlorophenyl)-2-(methoxymethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-bromo-2,3-dichlorophenyl)-2-(methoxymethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 107794910 |
| Molecular Formula | C12H11BrCl2N4O |
| Molecular Weight | 378.06 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 4-N-(4-bromo-2,3-dichlorophenyl)-2-(methoxymethyl)pyrimidine-4,6-diamine |
| SMILES | COCc1nc(N)cc(Nc2ccc(Br)c(Cl)c2Cl)n1 |
| InChI | InChI=1S/C12H11BrCl2N4O/c1-20-5-10-18-8(16)4-9(19-10)17-7-3-2-6(13)11(14)12(7)15/h2-4H,5H2,1H3,(H3,16,17,18,19) |
| InChIKey | AGAQAWNRLPRFCL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.06 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|